C17H16Cl2N4OS — CID 156694347
2-amino-N-[5-chloro-4-(4-chloro-1-methylpyrazol-5-yl)thiophen-2-yl]-2-phenylpropanamide (PubChem CID 156694347) has the molecular formula C17H16Cl2N4OS and a molecular weight of 395.32 g/mol. Its IUPAC name is 2-amino-N-[5-chloro-4-(4-chloro-1-methylpyrazol-5-yl)thiophen-2-yl]-2-phenylpropanamide.
| Compound Name | 2-amino-N-[5-chloro-4-(4-chloro-1-methylpyrazol-5-yl)thiophen-2-yl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 156694347 |
| Molecular Formula | C17H16Cl2N4OS |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-amino-N-[5-chloro-4-(4-chloro-1-methylpyrazol-5-yl)thiophen-2-yl]-2-phenylpropanamide |
| SMILES | Cn1ncc(Cl)c1-c1cc(NC(=O)C(C)(N)c2ccccc2)sc1Cl |
| InChI | InChI=1S/C17H16Cl2N4OS/c1-17(20,10-6-4-3-5-7-10)16(24)22-13-8-11(15(19)25-13)14-12(18)9-21-23(14)2/h3-9H,20H2,1-2H3,(H,22,24) |
| InChIKey | ZZVVYJIQKRMYPU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |