C42H58O5S2Si2 — CID 156694816
3-(1,1-diphenylethylsulfanyl)propyl-[3-(1,1-diphenylethylsulfanyl)propyl-diethoxysilyl]oxy-diethoxysilane (PubChem CID 156694816) has the molecular formula C42H58O5S2Si2 and a molecular weight of 763.23 g/mol. Its IUPAC name is 3-(1,1-diphenylethylsulfanyl)propyl-[3-(1,1-diphenylethylsulfanyl)propyl-diethoxysilyl]oxy-diethoxysilane.
| Compound Name | 3-(1,1-diphenylethylsulfanyl)propyl-[3-(1,1-diphenylethylsulfanyl)propyl-diethoxysilyl]oxy-diethoxysilane |
|---|---|
| PubChem CID | 156694816 |
| Molecular Formula | C42H58O5S2Si2 |
| Molecular Weight | 763.23 g/mol |
| Exact Mass | 762.33 |
| IUPAC Name | 3-(1,1-diphenylethylsulfanyl)propyl-[3-(1,1-diphenylethylsulfanyl)propyl-diethoxysilyl]oxy-diethoxysilane |
| SMILES | CCO[Si](CCCSC(C)(c1ccccc1)c1ccccc1)(OCC)O[Si](CCCSC(C)(c1ccccc1)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C42H58O5S2Si2/c1-7-43-50(44-8-2,35-23-33-48-41(5,37-25-15-11-16-26-37)38-27-17-12-18-28-38)47-51(45-9-3,46-10-4)36-24-34-49-42(6,39-29-19-13-20-30-39)40-31-21-14-22-32-40/h11-22,25-32H,7-10,23-24,33-36H2,1-6H3 |
| InChIKey | OJIOFFCBWIADID-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.23 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|