C13H17NO — CID 15669539
(1R,4R,5S)-2-benzyl-2-azabicyclo[2.2.1]heptan-5-ol (PubChem CID 15669539) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (1R,4R,5S)-2-benzyl-2-azabicyclo[2.2.1]heptan-5-ol.
| Compound Name | (1R,4R,5S)-2-benzyl-2-azabicyclo[2.2.1]heptan-5-ol |
|---|---|
| PubChem CID | 15669539 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (1R,4R,5S)-2-benzyl-2-azabicyclo[2.2.1]heptan-5-ol |
| SMILES | O[C@H]1C[C@H]2C[C@@H]1CN2Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO/c15-13-7-12-6-11(13)9-14(12)8-10-4-2-1-3-5-10/h1-5,11-13,15H,6-9H2/t11-,12-,13+/m1/s1 |
| InChIKey | WDBYOLRRCRYHIX-UPJWGTAASA-N |
| XLogP | 1.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |