C13H13BrN2O2 — CID 156695639
6-bromo-1-methyl-3-(oxolan-2-yl)quinoxalin-2-one (PubChem CID 156695639) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is 6-bromo-1-methyl-3-(oxolan-2-yl)quinoxalin-2-one.
| Compound Name | 6-bromo-1-methyl-3-(oxolan-2-yl)quinoxalin-2-one |
|---|---|
| PubChem CID | 156695639 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 6-bromo-1-methyl-3-(oxolan-2-yl)quinoxalin-2-one |
| SMILES | Cn1c(=O)c(C2CCCO2)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H13BrN2O2/c1-16-10-5-4-8(14)7-9(10)15-12(13(16)17)11-3-2-6-18-11/h4-5,7,11H,2-3,6H2,1H3 |
| InChIKey | GOZVDXQQTFGTEG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |