C23H12F4N2O3 — CID 156695735
4-[4-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 156695735) has the molecular formula C23H12F4N2O3 and a molecular weight of 440.35 g/mol. Its IUPAC name is 4-[4-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 156695735 |
| Molecular Formula | C23H12F4N2O3 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 4-[4-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-hydroxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(C=C3C(=O)Nc4ccc(F)cc43)c(O)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H12F4N2O3/c24-14-3-5-19-16(9-14)17(22(31)29-19)8-13-2-4-15(10-20(13)30)32-21-6-1-12(11-28)7-18(21)23(25,26)27/h1-10,30H,(H,29,31) |
| InChIKey | RAQDDAYALYTYKP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|