C20H26Cl2F2N8OS — CID 156696337
(5S)-2-amino-N-(cyclopropylmethyl)-5-[3-[[3-(difluoromethyl)-1-methylpyrazol-5-yl]amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;dihydrochloride (PubChem CID 156696337) has the molecular formula C20H26Cl2F2N8OS and a molecular weight of 535.45 g/mol. Its IUPAC name is (5S)-2-amino-N-(cyclopropylmethyl)-5-[3-[[3-(difluoromethyl)-1-methylpyrazol-5-yl]amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;dihydrochloride.
| Compound Name | (5S)-2-amino-N-(cyclopropylmethyl)-5-[3-[[3-(difluoromethyl)-1-methylpyrazol-5-yl]amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 156696337 |
| Molecular Formula | C20H26Cl2F2N8OS |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | (5S)-2-amino-N-(cyclopropylmethyl)-5-[3-[[3-(difluoromethyl)-1-methylpyrazol-5-yl]amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Cn1nc(C(F)F)cc1Nc1nncn1[C@H]1CCc2sc(N)c(C(=O)NCC3CC3)c2C1 |
| InChI | InChI=1S/C20H24F2N8OS.2ClH/c1-29-15(7-13(28-29)17(21)22)26-20-27-25-9-30(20)11-4-5-14-12(6-11)16(18(23)32-14)19(31)24-8-10-2-3-10;;/h7,9-11,17H,2-6,8,23H2,1H3,(H,24,31)(H,26,27);2*1H/t11-;;/m0../s1 |
| InChIKey | YYRUXYBFHSYNGD-IDMXKUIJSA-N |
| XLogP | 4.05 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|