C8H9F6N3O3 — CID 156696398
2-methyl-5-(2,2,2-trifluoroethoxy)-1H-pyrazol-2-ium-3-amine;2,2,2-trifluoroacetate (PubChem CID 156696398) has the molecular formula C8H9F6N3O3 and a molecular weight of 309.17 g/mol. Its IUPAC name is 2-methyl-5-(2,2,2-trifluoroethoxy)-1H-pyrazol-2-ium-3-amine;2,2,2-trifluoroacetate.
| Compound Name | 2-methyl-5-(2,2,2-trifluoroethoxy)-1H-pyrazol-2-ium-3-amine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156696398 |
| Molecular Formula | C8H9F6N3O3 |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-methyl-5-(2,2,2-trifluoroethoxy)-1H-pyrazol-2-ium-3-amine;2,2,2-trifluoroacetate |
| SMILES | C[n+]1[nH]c(OCC(F)(F)F)cc1N.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3O.C2HF3O2/c1-12-4(10)2-5(11-12)13-3-6(7,8)9;3-2(4,5)1(6)7/h2H,3H2,1H3,(H2,10,11);(H,6,7) |
| InChIKey | BEKSDWKTQOLKJG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|