About tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate
tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (PubChem CID 156697015) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
| PubChem CID | 156697015 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC1CN(C1CNC1)C2 |
| InChI | InChI=1S/C13H23N3O2/c1-13(2,3)18-12(17)16-9-4-10(16)8-15(7-9)11-5-14-6-11/h9-11,14H,4-8H2,1-3H3 |
| InChIKey | JJHOVVTTZHBLDL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate?
The IUPAC name of tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CID 156697015) is tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate.
What is the SMILES notation for tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate?
The canonical SMILES for tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate is CC(C)(C)OC(=O)N1C2CC1CN(C1CNC1)C2.
What is the InChIKey of tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate?
The InChIKey is JJHOVVTTZHBLDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2/c1-13(2,3)18-12(17)16-9-4-10(16)8-15(7-9)11-5-14-6-11/h9-11,14H,4-8H2,1-3H3.
What are the key properties of tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate?
tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate has a molecular weight of 253.35 g/mol, XLogP of 0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(azetidin-3-yl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate is sourced from PubChem (CID 156697015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).