C18H15ClIN3 — CID 156697189
4-chloro-2-iodo-3-(1-prop-2-enyl-2,3-dihydroindol-6-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 156697189) has the molecular formula C18H15ClIN3 and a molecular weight of 435.70 g/mol. Its IUPAC name is 4-chloro-2-iodo-3-(1-prop-2-enyl-2,3-dihydroindol-6-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-chloro-2-iodo-3-(1-prop-2-enyl-2,3-dihydroindol-6-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 156697189 |
| Molecular Formula | C18H15ClIN3 |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 4-chloro-2-iodo-3-(1-prop-2-enyl-2,3-dihydroindol-6-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C=CCN1CCc2ccc(-c3c(I)[nH]c4nccc(Cl)c34)cc21 |
| InChI | InChI=1S/C18H15ClIN3/c1-2-8-23-9-6-11-3-4-12(10-14(11)23)15-16-13(19)5-7-21-18(16)22-17(15)20/h2-5,7,10H,1,6,8-9H2,(H,21,22) |
| InChIKey | PDXIVIUWWJRPAR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|