About 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine
8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine (PubChem CID 156697428) has the molecular formula C7H7BrClN3
and a molecular weight of 248.51 g/mol. Its IUPAC name is 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine.
Molecular Properties
| Compound Name | 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine |
| PubChem CID | 156697428 |
| Molecular Formula | C7H7BrClN3 |
| Molecular Weight | 248.51 g/mol |
| Exact Mass | 246.95 |
| IUPAC Name | 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine |
| SMILES | CC1=C(Br)C2=NCCN2C(Cl)=N1 |
| InChI | InChI=1S/C7H7BrClN3/c1-4-5(8)6-10-2-3-12(6)7(9)11-4/h2-3H2,1H3 |
| InChIKey | OQPKGIDSAAJKDZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine?
The IUPAC name of 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine (CID 156697428) is 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine.
What is the SMILES notation for 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine?
The canonical SMILES for 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine is CC1=C(Br)C2=NCCN2C(Cl)=N1.
What is the InChIKey of 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine?
The InChIKey is OQPKGIDSAAJKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrClN3/c1-4-5(8)6-10-2-3-12(6)7(9)11-4/h2-3H2,1H3.
What are the key properties of 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine?
8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine has a molecular weight of 248.51 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-chloro-7-methyl-2,3-dihydroimidazo[1,2-c]pyrimidine is sourced from PubChem (CID 156697428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).