About 3-purin-9-ylheptan-1-ol
3-purin-9-ylheptan-1-ol (PubChem CID 156697628) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-purin-9-ylheptan-1-ol.
Molecular Properties
| Compound Name | 3-purin-9-ylheptan-1-ol |
| PubChem CID | 156697628 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-purin-9-ylheptan-1-ol |
| SMILES | CCCCC(CCO)n1cnc2cncnc21 |
| InChI | InChI=1S/C12H18N4O/c1-2-3-4-10(5-6-17)16-9-15-11-7-13-8-14-12(11)16/h7-10,17H,2-6H2,1H3 |
| InChIKey | YCQXKFKZAJOLAQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-purin-9-ylheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-purin-9-ylheptan-1-ol?
The IUPAC name of 3-purin-9-ylheptan-1-ol (CID 156697628) is 3-purin-9-ylheptan-1-ol.
What is the SMILES notation for 3-purin-9-ylheptan-1-ol?
The canonical SMILES for 3-purin-9-ylheptan-1-ol is CCCCC(CCO)n1cnc2cncnc21.
What is the InChIKey of 3-purin-9-ylheptan-1-ol?
The InChIKey is YCQXKFKZAJOLAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O/c1-2-3-4-10(5-6-17)16-9-15-11-7-13-8-14-12(11)16/h7-10,17H,2-6H2,1H3.
What are the key properties of 3-purin-9-ylheptan-1-ol?
3-purin-9-ylheptan-1-ol has a molecular weight of 234.30 g/mol, XLogP of 1.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-purin-9-ylheptan-1-ol is sourced from PubChem (CID 156697628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).