About 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide
1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide (PubChem CID 156698049) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide.
Molecular Properties
| Compound Name | 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide |
| PubChem CID | 156698049 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide |
| SMILES | CCCc1n(CCC)cc[n+]1Cc1ccc(C)cc1.[OH-] |
| InChI | InChI=1S/C17H25N2.H2O/c1-4-6-17-18(11-5-2)12-13-19(17)14-16-9-7-15(3)8-10-16;/h7-10,12-13H,4-6,11,14H2,1-3H3;1H2/q+1;/p-1 |
| InChIKey | YSJNUDDHDKUBLR-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 38.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide?
The IUPAC name of 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide (CID 156698049) is 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide.
What is the SMILES notation for 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide?
The canonical SMILES for 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide is CCCc1n(CCC)cc[n+]1Cc1ccc(C)cc1.[OH-].
What is the InChIKey of 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide?
The InChIKey is YSJNUDDHDKUBLR-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H25N2.H2O/c1-4-6-17-18(11-5-2)12-13-19(17)14-16-9-7-15(3)8-10-16;/h7-10,12-13H,4-6,11,14H2,1-3H3;1H2/q+1;/p-1.
What are the key properties of 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide?
1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide has a molecular weight of 274.41 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methylphenyl)methyl]-2,3-dipropylimidazol-1-ium hydroxide is sourced from PubChem (CID 156698049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).