About 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate
2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate (PubChem CID 156698147) has the molecular formula C15H25IN2O2
and a molecular weight of 392.28 g/mol. Its IUPAC name is 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate.
Molecular Properties
| Compound Name | 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate |
| PubChem CID | 156698147 |
| Molecular Formula | C15H25IN2O2 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate |
| SMILES | COc1cccc2c1c(CC[N+](C)(C)C)cn2C.O.[I-] |
| InChI | InChI=1S/C15H23N2O.HI.H2O/c1-16-11-12(9-10-17(2,3)4)15-13(16)7-6-8-14(15)18-5;;/h6-8,11H,9-10H2,1-5H3;1H;1H2/q+1;;/p-1 |
| InChIKey | YXWQGMZQDKHIJY-UHFFFAOYSA-M |
| XLogP | -1.39 |
| TPSA | 45.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate?
The IUPAC name of 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate (CID 156698147) is 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate.
What is the SMILES notation for 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate?
The canonical SMILES for 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate is COc1cccc2c1c(CC[N+](C)(C)C)cn2C.O.[I-].
What is the InChIKey of 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate?
The InChIKey is YXWQGMZQDKHIJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H23N2O.HI.H2O/c1-16-11-12(9-10-17(2,3)4)15-13(16)7-6-8-14(15)18-5;;/h6-8,11H,9-10H2,1-5H3;1H;1H2/q+1;;/p-1.
What are the key properties of 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate?
2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate has a molecular weight of 392.28 g/mol, XLogP of -1.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-1-methylindol-3-yl)ethyl-trimethylazanium;iodide;hydrate is sourced from PubChem (CID 156698147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).