C18H15NO3 — CID 156698371
5-methoxy-3,4-dimethyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-8,15-dione (PubChem CID 156698371) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 5-methoxy-3,4-dimethyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-8,15-dione.
| Compound Name | 5-methoxy-3,4-dimethyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-8,15-dione |
|---|---|
| PubChem CID | 156698371 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 5-methoxy-3,4-dimethyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-8,15-dione |
| SMILES | COc1cc2c(=O)c3cccc4c3n(c2c(C)c1C)C(=O)C4 |
| InChI | InChI=1S/C18H15NO3/c1-9-10(2)16-13(8-14(9)22-3)18(21)12-6-4-5-11-7-15(20)19(16)17(11)12/h4-6,8H,7H2,1-3H3 |
| InChIKey | HBVKHCPXLJQEGY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|