C22H27N7O2 — CID 156699115
(3E)-3-hydroxyimino-6-[3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-c]pyridazin-6-yl]-1,2-dihydroinden-5-ol (PubChem CID 156699115) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is (3E)-3-hydroxyimino-6-[3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-c]pyridazin-6-yl]-1,2-dihydroinden-5-ol.
| Compound Name | (3E)-3-hydroxyimino-6-[3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-c]pyridazin-6-yl]-1,2-dihydroinden-5-ol |
|---|---|
| PubChem CID | 156699115 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (3E)-3-hydroxyimino-6-[3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-c]pyridazin-6-yl]-1,2-dihydroinden-5-ol |
| SMILES | CC1(C)CC(n2nnc3cc(-c4cc5c(cc4O)/C(=N/O)CC5)nnc32)CC(C)(C)N1 |
| InChI | InChI=1S/C22H27N7O2/c1-21(2)10-13(11-22(3,4)27-21)29-20-18(24-28-29)9-17(23-25-20)15-7-12-5-6-16(26-31)14(12)8-19(15)30/h7-9,13,27,30-31H,5-6,10-11H2,1-4H3/b26-16+ |
| InChIKey | LNAFRHAHLZMSDN-WGOQTCKBSA-N |
| XLogP | 3.20 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|