C32H48F3N5O6SSi — CID 156699186
[5-[2-(methoxymethoxy)-4-tri(propan-2-yl)silyloxyphenyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-3-yl] trifluoromethanesulfonate (PubChem CID 156699186) has the molecular formula C32H48F3N5O6SSi and a molecular weight of 715.91 g/mol. Its IUPAC name is [5-[2-(methoxymethoxy)-4-tri(propan-2-yl)silyloxyphenyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-3-yl] trifluoromethanesulfonate.
| Compound Name | [5-[2-(methoxymethoxy)-4-tri(propan-2-yl)silyloxyphenyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156699186 |
| Molecular Formula | C32H48F3N5O6SSi |
| Molecular Weight | 715.91 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | [5-[2-(methoxymethoxy)-4-tri(propan-2-yl)silyloxyphenyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-3-yl] trifluoromethanesulfonate |
| SMILES | COCOc1cc(O[Si](C(C)C)(C(C)C)C(C)C)ccc1-c1cc2c(OS(=O)(=O)C(F)(F)F)nn(C3CC(C)(C)NC(C)(C)C3)c2nn1 |
| InChI | InChI=1S/C32H48F3N5O6SSi/c1-19(2)48(20(3)4,21(5)6)46-23-12-13-24(27(14-23)44-18-43-11)26-15-25-28(37-36-26)40(22-16-30(7,8)39-31(9,10)17-22)38-29(25)45-47(41,42)32(33,34)35/h12-15,19-22,39H,16-18H2,1-11H3 |
| InChIKey | NWHWNQQAGIJHTA-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.91 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|