C23H28F3N5O5S — CID 156699246
[3-(methoxymethoxy)-4-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-5-yl]phenyl] trifluoromethanesulfonate (PubChem CID 156699246) has the molecular formula C23H28F3N5O5S and a molecular weight of 543.57 g/mol. Its IUPAC name is [3-(methoxymethoxy)-4-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-5-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(methoxymethoxy)-4-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-5-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156699246 |
| Molecular Formula | C23H28F3N5O5S |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | [3-(methoxymethoxy)-4-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-5-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COCOc1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1cc2cnn(C3CC(C)(C)NC(C)(C)C3)c2nn1 |
| InChI | InChI=1S/C23H28F3N5O5S/c1-21(2)10-15(11-22(3,4)30-21)31-20-14(12-27-31)8-18(28-29-20)17-7-6-16(9-19(17)35-13-34-5)36-37(32,33)23(24,25)26/h6-9,12,15,30H,10-11,13H2,1-5H3 |
| InChIKey | DHNLFFNEJDIKKI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|