C27H32FN7O3 — CID 156699299
4-[4-[3-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]triazolo[4,5-c]pyridazin-6-yl]-3-(methoxymethoxy)phenyl]-1-methylpyridin-2-one (PubChem CID 156699299) has the molecular formula C27H32FN7O3 and a molecular weight of 521.60 g/mol. Its IUPAC name is 4-[4-[3-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]triazolo[4,5-c]pyridazin-6-yl]-3-(methoxymethoxy)phenyl]-1-methylpyridin-2-one.
| Compound Name | 4-[4-[3-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]triazolo[4,5-c]pyridazin-6-yl]-3-(methoxymethoxy)phenyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 156699299 |
| Molecular Formula | C27H32FN7O3 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 4-[4-[3-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]triazolo[4,5-c]pyridazin-6-yl]-3-(methoxymethoxy)phenyl]-1-methylpyridin-2-one |
| SMILES | COCOc1cc(-c2ccn(C)c(=O)c2)ccc1-c1cc2nnn([C@H]3CC(C)(C)NC(C)(C)[C@H]3F)c2nn1 |
| InChI | InChI=1S/C27H32FN7O3/c1-26(2)14-21(24(28)27(3,4)32-26)35-25-20(30-33-35)13-19(29-31-25)18-8-7-16(11-22(18)38-15-37-6)17-9-10-34(5)23(36)12-17/h7-13,21,24,32H,14-15H2,1-6H3/t21-,24-/m0/s1 |
| InChIKey | OYKRSGXYQFCZOK-URXFXBBRSA-N |
| XLogP | 3.67 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|