About 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol
1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol (PubChem CID 156700086) has the molecular formula C18H38O2
and a molecular weight of 286.50 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol |
| PubChem CID | 156700086 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol |
| SMILES | CC(C)C1CCC(C)(O)CC1.CCCCCCCCO |
| InChI | InChI=1S/C10H20O.C8H18O/c1-8(2)9-4-6-10(3,11)7-5-9;1-2-3-4-5-6-7-8-9/h8-9,11H,4-7H2,1-3H3;9H,2-8H2,1H3 |
| InChIKey | KALONJKTNDWUIW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol?
The IUPAC name of 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol (CID 156700086) is 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol.
What is the SMILES notation for 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol?
The canonical SMILES for 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol is CC(C)C1CCC(C)(O)CC1.CCCCCCCCO.
What is the InChIKey of 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol?
The InChIKey is KALONJKTNDWUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C8H18O/c1-8(2)9-4-6-10(3,11)7-5-9;1-2-3-4-5-6-7-8-9/h8-9,11H,4-7H2,1-3H3;9H,2-8H2,1H3.
What are the key properties of 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol?
1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol has a molecular weight of 286.50 g/mol, XLogP of 4.92, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylcyclohexan-1-ol;octan-1-ol is sourced from PubChem (CID 156700086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).