C22H19F7N6O2 — CID 156700711
N-(cyclopropylmethyl)-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]-3-(1,1,2,2-tetrafluoroethoxy)-5-(trifluoromethyl)benzamide (PubChem CID 156700711) has the molecular formula C22H19F7N6O2 and a molecular weight of 532.42 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]-3-(1,1,2,2-tetrafluoroethoxy)-5-(trifluoromethyl)benzamide.
| Compound Name | N-(cyclopropylmethyl)-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]-3-(1,1,2,2-tetrafluoroethoxy)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 156700711 |
| Molecular Formula | C22H19F7N6O2 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]-3-(1,1,2,2-tetrafluoroethoxy)-5-(trifluoromethyl)benzamide |
| SMILES | CC(c1ncnn1-c1ncccn1)N(CC1CC1)C(=O)c1cc(OC(F)(F)C(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F7N6O2/c1-12(17-32-11-33-35(17)20-30-5-2-6-31-20)34(10-13-3-4-13)18(36)14-7-15(21(25,26)27)9-16(8-14)37-22(28,29)19(23)24/h2,5-9,11-13,19H,3-4,10H2,1H3 |
| InChIKey | JNKJDQWUAPULIU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|