About 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole
2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole (PubChem CID 156700977) has the molecular formula C19H15F2N3OS
and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole |
| PubChem CID | 156700977 |
| Molecular Formula | C19H15F2N3OS |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole |
| SMILES | Fc1ccc(C(Cn2ccnc2)OCc2nc3ccccc3s2)cc1F |
| InChI | InChI=1S/C19H15F2N3OS/c20-14-6-5-13(9-15(14)21)17(10-24-8-7-22-12-24)25-11-19-23-16-3-1-2-4-18(16)26-19/h1-9,12,17H,10-11H2 |
| InChIKey | BNQXCIUECRAWBD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole?
The IUPAC name of 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole (CID 156700977) is 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole?
The canonical SMILES for 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole is Fc1ccc(C(Cn2ccnc2)OCc2nc3ccccc3s2)cc1F.
What is the InChIKey of 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole?
The InChIKey is BNQXCIUECRAWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2N3OS/c20-14-6-5-13(9-15(14)21)17(10-24-8-7-22-12-24)25-11-19-23-16-3-1-2-4-18(16)26-19/h1-9,12,17H,10-11H2.
What are the key properties of 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole?
2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole has a molecular weight of 371.41 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(3,4-difluorophenyl)-2-imidazol-1-ylethoxy]methyl]-1,3-benzothiazole is sourced from PubChem (CID 156700977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).