C38H37FN10O4S — CID 156701737
3-[[4-[benzenesulfonyl(methyl)amino]-2-fluorobenzoyl]amino]-N,N-bis[(3R)-1-cyanopyrrolidin-3-yl]-1-methyl-6-(1-methylpyrazol-4-yl)indole-2-carboxamide (PubChem CID 156701737) has the molecular formula C38H37FN10O4S and a molecular weight of 748.85 g/mol. Its IUPAC name is 3-[[4-[benzenesulfonyl(methyl)amino]-2-fluorobenzoyl]amino]-N,N-bis[(3R)-1-cyanopyrrolidin-3-yl]-1-methyl-6-(1-methylpyrazol-4-yl)indole-2-carboxamide.
| Compound Name | 3-[[4-[benzenesulfonyl(methyl)amino]-2-fluorobenzoyl]amino]-N,N-bis[(3R)-1-cyanopyrrolidin-3-yl]-1-methyl-6-(1-methylpyrazol-4-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 156701737 |
| Molecular Formula | C38H37FN10O4S |
| Molecular Weight | 748.85 g/mol |
| Exact Mass | 748.27 |
| IUPAC Name | 3-[[4-[benzenesulfonyl(methyl)amino]-2-fluorobenzoyl]amino]-N,N-bis[(3R)-1-cyanopyrrolidin-3-yl]-1-methyl-6-(1-methylpyrazol-4-yl)indole-2-carboxamide |
| SMILES | CN(c1ccc(C(=O)Nc2c(C(=O)N([C@@H]3CCN(C#N)C3)[C@@H]3CCN(C#N)C3)n(C)c3cc(-c4cnn(C)c4)ccc23)c(F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C38H37FN10O4S/c1-44-20-26(19-42-44)25-9-11-32-34(17-25)45(2)36(38(51)49(28-13-15-47(21-28)23-40)29-14-16-48(22-29)24-41)35(32)43-37(50)31-12-10-27(18-33(31)39)46(3)54(52,53)30-7-5-4-6-8-30/h4-12,17-20,28-29H,13-16,21-22H2,1-3H3,(H,43,50)/t28-,29-/m1/s1 |
| InChIKey | XRBFBTJEXAFZTN-FQLXRVMXSA-N |
| XLogP | 4.35 |
| TPSA | 163.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|