About 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole
2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole (PubChem CID 156701775) has the molecular formula C18H11N5
and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole.
Molecular Properties
| Compound Name | 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole |
| PubChem CID | 156701775 |
| Molecular Formula | C18H11N5 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole |
| SMILES | c1ccc2c(c1)ccc1c2ccc2[nH]c(-c3ccnnn3)nc21 |
| InChI | InChI=1S/C18H11N5/c1-2-4-12-11(3-1)5-6-14-13(12)7-8-15-17(14)21-18(20-15)16-9-10-19-23-22-16/h1-10H,(H,20,21) |
| InChIKey | XTCWCMPZGJEWPL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole?
The IUPAC name of 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole (CID 156701775) is 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole.
What is the SMILES notation for 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole?
The canonical SMILES for 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole is c1ccc2c(c1)ccc1c2ccc2[nH]c(-c3ccnnn3)nc21.
What is the InChIKey of 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole?
The InChIKey is XTCWCMPZGJEWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N5/c1-2-4-12-11(3-1)5-6-14-13(12)7-8-15-17(14)21-18(20-15)16-9-10-19-23-22-16/h1-10H,(H,20,21).
What are the key properties of 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole?
2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole has a molecular weight of 297.32 g/mol, XLogP of 3.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazin-4-yl)-1H-naphtho[2,1-e]benzimidazole is sourced from PubChem (CID 156701775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).