About 1-(diethyl-λ3-iodanyl)piperidin-4-one
1-(diethyl-λ3-iodanyl)piperidin-4-one (PubChem CID 156702521) has the molecular formula C9H18INO
and a molecular weight of 283.15 g/mol. Its IUPAC name is 1-(diethyl-λ3-iodanyl)piperidin-4-one.
Molecular Properties
| Compound Name | 1-(diethyl-λ3-iodanyl)piperidin-4-one |
| PubChem CID | 156702521 |
| Molecular Formula | C9H18INO |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 1-(diethyl-λ3-iodanyl)piperidin-4-one |
| SMILES | CCI(CC)N1CCC(=O)CC1 |
| InChI | InChI=1S/C9H18INO/c1-3-10(4-2)11-7-5-9(12)6-8-11/h3-8H2,1-2H3 |
| InChIKey | JGUDZLUJWLMSHH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(diethyl-λ3-iodanyl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethyl-λ3-iodanyl)piperidin-4-one?
The IUPAC name of 1-(diethyl-λ3-iodanyl)piperidin-4-one (CID 156702521) is 1-(diethyl-λ3-iodanyl)piperidin-4-one.
What is the SMILES notation for 1-(diethyl-λ3-iodanyl)piperidin-4-one?
The canonical SMILES for 1-(diethyl-λ3-iodanyl)piperidin-4-one is CCI(CC)N1CCC(=O)CC1.
What is the InChIKey of 1-(diethyl-λ3-iodanyl)piperidin-4-one?
The InChIKey is JGUDZLUJWLMSHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18INO/c1-3-10(4-2)11-7-5-9(12)6-8-11/h3-8H2,1-2H3.
What are the key properties of 1-(diethyl-λ3-iodanyl)piperidin-4-one?
1-(diethyl-λ3-iodanyl)piperidin-4-one has a molecular weight of 283.15 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethyl-λ3-iodanyl)piperidin-4-one is sourced from PubChem (CID 156702521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).