C15H17FN4O — CID 156703425
6-amino-6-fluoro-5-[4-(1,2,3,6-tetrahydropyridin-4-yl)pyridazin-3-yl]cyclohexa-2,4-dien-1-ol (PubChem CID 156703425) has the molecular formula C15H17FN4O and a molecular weight of 288.33 g/mol. Its IUPAC name is 6-amino-6-fluoro-5-[4-(1,2,3,6-tetrahydropyridin-4-yl)pyridazin-3-yl]cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-amino-6-fluoro-5-[4-(1,2,3,6-tetrahydropyridin-4-yl)pyridazin-3-yl]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 156703425 |
| Molecular Formula | C15H17FN4O |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 6-amino-6-fluoro-5-[4-(1,2,3,6-tetrahydropyridin-4-yl)pyridazin-3-yl]cyclohexa-2,4-dien-1-ol |
| SMILES | NC1(F)C(c2nnccc2C2=CCNCC2)=CC=CC1O |
| InChI | InChI=1S/C15H17FN4O/c16-15(17)12(2-1-3-13(15)21)14-11(6-9-19-20-14)10-4-7-18-8-5-10/h1-4,6,9,13,18,21H,5,7-8,17H2 |
| InChIKey | CUPDXTXPZFAURQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|