C22H31N5OS — CID 156704328
3-[4-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]cyclohex-3-en-1-yl]-1,1-dimethylurea (PubChem CID 156704328) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 3-[4-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]cyclohex-3-en-1-yl]-1,1-dimethylurea.
| Compound Name | 3-[4-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]cyclohex-3-en-1-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 156704328 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 3-[4-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]cyclohex-3-en-1-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1CC=C(CCN2CCN(c3nsc4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C22H31N5OS/c1-25(2)22(28)23-18-9-7-17(8-10-18)11-12-26-13-15-27(16-14-26)21-19-5-3-4-6-20(19)29-24-21/h3-7,18H,8-16H2,1-2H3,(H,23,28) |
| InChIKey | NSMYMYRVRURGRV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|