About [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol
[2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol (PubChem CID 156704493) has the molecular formula C10H10Cl2FN3O
and a molecular weight of 278.11 g/mol. Its IUPAC name is [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol.
Molecular Properties
| Compound Name | [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol |
| PubChem CID | 156704493 |
| Molecular Formula | C10H10Cl2FN3O |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol |
| SMILES | OCC12CC(F)(CN1c1cc(Cl)nc(Cl)n1)C2 |
| InChI | InChI=1S/C10H10Cl2FN3O/c11-6-1-7(15-8(12)14-6)16-4-9(13)2-10(16,3-9)5-17/h1,17H,2-5H2 |
| InChIKey | WTEUEVSRMZAZMM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol?
The IUPAC name of [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol (CID 156704493) is [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol.
What is the SMILES notation for [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol?
The canonical SMILES for [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol is OCC12CC(F)(CN1c1cc(Cl)nc(Cl)n1)C2.
What is the InChIKey of [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol?
The InChIKey is WTEUEVSRMZAZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2FN3O/c11-6-1-7(15-8(12)14-6)16-4-9(13)2-10(16,3-9)5-17/h1,17H,2-5H2.
What are the key properties of [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol?
[2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol has a molecular weight of 278.11 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dichloropyrimidin-4-yl)-4-fluoro-2-azabicyclo[2.1.1]hexan-1-yl]methanol is sourced from PubChem (CID 156704493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).