About 2-azido-1,5-dimethylcyclopenta-1,3-diene
2-azido-1,5-dimethylcyclopenta-1,3-diene (PubChem CID 156704827) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-azido-1,5-dimethylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 2-azido-1,5-dimethylcyclopenta-1,3-diene |
| PubChem CID | 156704827 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2-azido-1,5-dimethylcyclopenta-1,3-diene |
| SMILES | CC1=C(N=[N+]=[N-])C=CC1C |
| InChI | InChI=1S/C7H9N3/c1-5-3-4-7(6(5)2)9-10-8/h3-5H,1-2H3 |
| InChIKey | QKHKBBIIFDCPSG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-1,5-dimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-1,5-dimethylcyclopenta-1,3-diene?
The IUPAC name of 2-azido-1,5-dimethylcyclopenta-1,3-diene (CID 156704827) is 2-azido-1,5-dimethylcyclopenta-1,3-diene.
What is the SMILES notation for 2-azido-1,5-dimethylcyclopenta-1,3-diene?
The canonical SMILES for 2-azido-1,5-dimethylcyclopenta-1,3-diene is CC1=C(N=[N+]=[N-])C=CC1C.
What is the InChIKey of 2-azido-1,5-dimethylcyclopenta-1,3-diene?
The InChIKey is QKHKBBIIFDCPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-5-3-4-7(6(5)2)9-10-8/h3-5H,1-2H3.
What are the key properties of 2-azido-1,5-dimethylcyclopenta-1,3-diene?
2-azido-1,5-dimethylcyclopenta-1,3-diene has a molecular weight of 135.17 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1,5-dimethylcyclopenta-1,3-diene is sourced from PubChem (CID 156704827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).