About N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine
N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine (PubChem CID 156704942) has the molecular formula C17H28N4O
and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine |
| PubChem CID | 156704942 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(C)CCNc1nc2ccccc2n1CCOCC |
| InChI | InChI=1S/C17H28N4O/c1-4-11-20(3)12-10-18-17-19-15-8-6-7-9-16(15)21(17)13-14-22-5-2/h6-9H,4-5,10-14H2,1-3H3,(H,18,19) |
| InChIKey | FYDCUUCLTSLVHD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine?
The IUPAC name of N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine (CID 156704942) is N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine.
What is the SMILES notation for N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine?
The canonical SMILES for N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine is CCCN(C)CCNc1nc2ccccc2n1CCOCC.
What is the InChIKey of N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine?
The InChIKey is FYDCUUCLTSLVHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O/c1-4-11-20(3)12-10-18-17-19-15-8-6-7-9-16(15)21(17)13-14-22-5-2/h6-9H,4-5,10-14H2,1-3H3,(H,18,19).
What are the key properties of N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine?
N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine has a molecular weight of 304.44 g/mol, XLogP of 2.83, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N'-methyl-N'-propylethane-1,2-diamine is sourced from PubChem (CID 156704942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).