C19H18ClN3O4 — CID 156704951
2-[6-amino-2-(3-chlorophenyl)-5-(2-methoxyphenoxy)pyrimidin-4-yl]oxyethanol (PubChem CID 156704951) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-[6-amino-2-(3-chlorophenyl)-5-(2-methoxyphenoxy)pyrimidin-4-yl]oxyethanol.
| Compound Name | 2-[6-amino-2-(3-chlorophenyl)-5-(2-methoxyphenoxy)pyrimidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 156704951 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-[6-amino-2-(3-chlorophenyl)-5-(2-methoxyphenoxy)pyrimidin-4-yl]oxyethanol |
| SMILES | COc1ccccc1Oc1c(N)nc(-c2cccc(Cl)c2)nc1OCCO |
| InChI | InChI=1S/C19H18ClN3O4/c1-25-14-7-2-3-8-15(14)27-16-17(21)22-18(23-19(16)26-10-9-24)12-5-4-6-13(20)11-12/h2-8,11,24H,9-10H2,1H3,(H2,21,22,23) |
| InChIKey | XLVGICCPIJYDIF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |