C34H34ClN3O4 — CID 156705400
[(1S,2R,3S,4R)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,3-bis(phenylmethoxy)-1-(phenylmethoxymethyl)cyclopentyl]methanol (PubChem CID 156705400) has the molecular formula C34H34ClN3O4 and a molecular weight of 584.12 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,3-bis(phenylmethoxy)-1-(phenylmethoxymethyl)cyclopentyl]methanol.
| Compound Name | [(1S,2R,3S,4R)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,3-bis(phenylmethoxy)-1-(phenylmethoxymethyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 156705400 |
| Molecular Formula | C34H34ClN3O4 |
| Molecular Weight | 584.12 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | [(1S,2R,3S,4R)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,3-bis(phenylmethoxy)-1-(phenylmethoxymethyl)cyclopentyl]methanol |
| SMILES | OC[C@]1(COCc2ccccc2)C[C@@H](n2ccc3c(Cl)ncnc32)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H34ClN3O4/c35-32-28-16-17-38(33(28)37-24-36-32)29-18-34(22-39,23-40-19-25-10-4-1-5-11-25)31(42-21-27-14-8-3-9-15-27)30(29)41-20-26-12-6-2-7-13-26/h1-17,24,29-31,39H,18-23H2/t29-,30+,31+,34+/m1/s1 |
| InChIKey | KCDGCTCCLRDRNB-ZOBNFCAWSA-N |
| XLogP | 6.40 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.12 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |