C20H22BNO2 — CID 156705447
10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenanthren-9-amine (PubChem CID 156705447) has the molecular formula C20H22BNO2 and a molecular weight of 319.21 g/mol. Its IUPAC name is 10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenanthren-9-amine.
| Compound Name | 10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenanthren-9-amine |
|---|---|
| PubChem CID | 156705447 |
| Molecular Formula | C20H22BNO2 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenanthren-9-amine |
| SMILES | CC1(C)OB(c2c(N)c3ccccc3c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C20H22BNO2/c1-19(2)20(3,4)24-21(23-19)17-15-11-7-5-9-13(15)14-10-6-8-12-16(14)18(17)22/h5-12H,22H2,1-4H3 |
| InChIKey | FSKRCPNPFQBVJW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|