C25H29FN6O2S — CID 156706754
N-[1-[(E)-N-[1-(2-cyclopropyl-2-sulfanylhydrazinyl)ethenyl]-C-[(Z)-prop-1-enyl]carbonimidoyl]cyclopropyl]-4-(6-ethoxypyrazin-2-yl)-2-fluorobenzamide (PubChem CID 156706754) has the molecular formula C25H29FN6O2S and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[1-[(E)-N-[1-(2-cyclopropyl-2-sulfanylhydrazinyl)ethenyl]-C-[(Z)-prop-1-enyl]carbonimidoyl]cyclopropyl]-4-(6-ethoxypyrazin-2-yl)-2-fluorobenzamide.
| Compound Name | N-[1-[(E)-N-[1-(2-cyclopropyl-2-sulfanylhydrazinyl)ethenyl]-C-[(Z)-prop-1-enyl]carbonimidoyl]cyclopropyl]-4-(6-ethoxypyrazin-2-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 156706754 |
| Molecular Formula | C25H29FN6O2S |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[1-[(E)-N-[1-(2-cyclopropyl-2-sulfanylhydrazinyl)ethenyl]-C-[(Z)-prop-1-enyl]carbonimidoyl]cyclopropyl]-4-(6-ethoxypyrazin-2-yl)-2-fluorobenzamide |
| SMILES | C=C(/N=C(\C=C/C)C1(NC(=O)c2ccc(-c3cncc(OCC)n3)cc2F)CC1)NN(S)C1CC1 |
| InChI | InChI=1S/C25H29FN6O2S/c1-4-6-22(28-16(3)31-32(35)18-8-9-18)25(11-12-25)30-24(33)19-10-7-17(13-20(19)26)21-14-27-15-23(29-21)34-5-2/h4,6-7,10,13-15,18,31,35H,3,5,8-9,11-12H2,1-2H3,(H,30,33)/b6-4-,28-22+ |
| InChIKey | HKKAKMZMBVCELP-SLFXTNDKSA-N |
| XLogP | 4.25 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|