About 2,6-dimethyl-2,3-dihydropyridine;ethane
2,6-dimethyl-2,3-dihydropyridine;ethane (PubChem CID 156706966) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 2,6-dimethyl-2,3-dihydropyridine;ethane.
Molecular Properties
| Compound Name | 2,6-dimethyl-2,3-dihydropyridine;ethane |
| PubChem CID | 156706966 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 2,6-dimethyl-2,3-dihydropyridine;ethane |
| SMILES | CC.CC1=NC(C)CC=C1 |
| InChI | InChI=1S/C7H11N.C2H6/c1-6-4-3-5-7(2)8-6;1-2/h3-4,7H,5H2,1-2H3;1-2H3 |
| InChIKey | NVSKNTOBLHHAJY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dimethyl-2,3-dihydropyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2,3-dihydropyridine;ethane?
The IUPAC name of 2,6-dimethyl-2,3-dihydropyridine;ethane (CID 156706966) is 2,6-dimethyl-2,3-dihydropyridine;ethane.
What is the SMILES notation for 2,6-dimethyl-2,3-dihydropyridine;ethane?
The canonical SMILES for 2,6-dimethyl-2,3-dihydropyridine;ethane is CC.CC1=NC(C)CC=C1.
What is the InChIKey of 2,6-dimethyl-2,3-dihydropyridine;ethane?
The InChIKey is NVSKNTOBLHHAJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C2H6/c1-6-4-3-5-7(2)8-6;1-2/h3-4,7H,5H2,1-2H3;1-2H3.
What are the key properties of 2,6-dimethyl-2,3-dihydropyridine;ethane?
2,6-dimethyl-2,3-dihydropyridine;ethane has a molecular weight of 139.24 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2,3-dihydropyridine;ethane is sourced from PubChem (CID 156706966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).