About 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene
3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene (PubChem CID 156707077) has the molecular formula C20H34N2O3
and a molecular weight of 350.50 g/mol. Its IUPAC name is 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene.
Molecular Properties
| Compound Name | 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene |
| PubChem CID | 156707077 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene |
| SMILES | C=C.C=Cc1oc(C)c(N(C=O)CCC(=O)NC)c1C=C.CC.CC |
| InChI | InChI=1S/C14H18N2O3.2C2H6.C2H4/c1-5-11-12(6-2)19-10(3)14(11)16(9-17)8-7-13(18)15-4;3*1-2/h5-6,9H,1-2,7-8H2,3-4H3,(H,15,18);2*1-2H3;1-2H2 |
| InChIKey | PORYFGHZXXZEIY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene?
The IUPAC name of 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene (CID 156707077) is 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene.
What is the SMILES notation for 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene?
The canonical SMILES for 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene is C=C.C=Cc1oc(C)c(N(C=O)CCC(=O)NC)c1C=C.CC.CC.
What is the InChIKey of 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene?
The InChIKey is PORYFGHZXXZEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3.2C2H6.C2H4/c1-5-11-12(6-2)19-10(3)14(11)16(9-17)8-7-13(18)15-4;3*1-2/h5-6,9H,1-2,7-8H2,3-4H3,(H,15,18);2*1-2H3;1-2H2.
What are the key properties of 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene?
3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene has a molecular weight of 350.50 g/mol, XLogP of 4.83, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4,5-bis(ethenyl)-2-methylfuran-3-yl]-formylamino]-N-methylpropanamide;ethane;ethene is sourced from PubChem (CID 156707077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).