C13H23FN2O3 — CID 156707412
1-[4-[(3-fluoro-4-hydroxypiperidin-1-yl)methyl]piperidin-1-yl]-2-hydroxyethanone (PubChem CID 156707412) has the molecular formula C13H23FN2O3 and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-[4-[(3-fluoro-4-hydroxypiperidin-1-yl)methyl]piperidin-1-yl]-2-hydroxyethanone.
| Compound Name | 1-[4-[(3-fluoro-4-hydroxypiperidin-1-yl)methyl]piperidin-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 156707412 |
| Molecular Formula | C13H23FN2O3 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[4-[(3-fluoro-4-hydroxypiperidin-1-yl)methyl]piperidin-1-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1CCC(CN2CCC(O)C(F)C2)CC1 |
| InChI | InChI=1S/C13H23FN2O3/c14-11-8-15(4-3-12(11)18)7-10-1-5-16(6-2-10)13(19)9-17/h10-12,17-18H,1-9H2 |
| InChIKey | GSNWSJVIWHNPRF-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |