C20H32BNO5 — CID 156707447
4-[[2,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]piperidine (PubChem CID 156707447) has the molecular formula C20H32BNO5 and a molecular weight of 377.29 g/mol. Its IUPAC name is 4-[[2,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]piperidine.
| Compound Name | 4-[[2,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 156707447 |
| Molecular Formula | C20H32BNO5 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 4-[[2,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]piperidine |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)cc(OC)c1OCC1CCNCC1 |
| InChI | InChI=1S/C20H32BNO5/c1-19(2)20(3,4)27-21(26-19)15-11-16(23-5)18(17(12-15)24-6)25-13-14-7-9-22-10-8-14/h11-12,14,22H,7-10,13H2,1-6H3 |
| InChIKey | YINJBSVSKRRATL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|