About 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde
2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde (PubChem CID 156707450) has the molecular formula C19H36N2O3
and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde |
| PubChem CID | 156707450 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde |
| SMILES | CC(C)C.CC(C)C(=O)N1CCC(OC2CCN(C=O)CC2)CC1 |
| InChI | InChI=1S/C15H26N2O3.C4H10/c1-12(2)15(19)17-9-5-14(6-10-17)20-13-3-7-16(11-18)8-4-13;1-4(2)3/h11-14H,3-10H2,1-2H3;4H,1-3H3 |
| InChIKey | YILMZQIDCGOLDV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde?
The IUPAC name of 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde (CID 156707450) is 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde.
What is the SMILES notation for 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde?
The canonical SMILES for 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde is CC(C)C.CC(C)C(=O)N1CCC(OC2CCN(C=O)CC2)CC1.
What is the InChIKey of 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde?
The InChIKey is YILMZQIDCGOLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3.C4H10/c1-12(2)15(19)17-9-5-14(6-10-17)20-13-3-7-16(11-18)8-4-13;1-4(2)3/h11-14H,3-10H2,1-2H3;4H,1-3H3.
What are the key properties of 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde?
2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde has a molecular weight of 340.51 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;4-[1-(2-methylpropanoyl)piperidin-4-yl]oxypiperidine-1-carbaldehyde is sourced from PubChem (CID 156707450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).