About dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate
dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate (PubChem CID 15670774) has the molecular formula C17H30O7
and a molecular weight of 346.42 g/mol. Its IUPAC name is dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate |
| PubChem CID | 15670774 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate |
| SMILES | COC(=O)CC(C(=O)CC[C@H](CC(OC)OC)C(C)C)C(=O)OC |
| InChI | InChI=1S/C17H30O7/c1-11(2)12(9-16(22-4)23-5)7-8-14(18)13(17(20)24-6)10-15(19)21-3/h11-13,16H,7-10H2,1-6H3/t12-,13?/m1/s1 |
| InChIKey | RMLUPHWGGYVINI-PZORYLMUSA-N |
| XLogP | 1.97 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate?
The IUPAC name of dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate (CID 15670774) is dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate.
What is the SMILES notation for dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate?
The canonical SMILES for dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate is COC(=O)CC(C(=O)CC[C@H](CC(OC)OC)C(C)C)C(=O)OC.
What is the InChIKey of dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate?
The InChIKey is RMLUPHWGGYVINI-PZORYLMUSA-N. The full InChI is InChI=1S/C17H30O7/c1-11(2)12(9-16(22-4)23-5)7-8-14(18)13(17(20)24-6)10-15(19)21-3/h11-13,16H,7-10H2,1-6H3/t12-,13?/m1/s1.
What are the key properties of dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate?
dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate has a molecular weight of 346.42 g/mol, XLogP of 1.97, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate is sourced from PubChem (CID 15670774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).