C14H26CsNO4 — CID 156707801
cesium;carbanide;2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 156707801) has the molecular formula C14H26CsNO4 and a molecular weight of 405.27 g/mol. Its IUPAC name is cesium;carbanide;2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | cesium;carbanide;2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 156707801 |
| Molecular Formula | C14H26CsNO4 |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | cesium;carbanide;2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C1CCCCC1.[CH3-].[Cs+] |
| InChI | InChI=1S/C13H23NO4.CH3.Cs/c1-13(2,3)18-12(17)14-10(11(15)16)9-7-5-4-6-8-9;;/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16);1H3;/q;-1;+1 |
| InChIKey | WXNKXABEYREIAJ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|