About 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane
2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 156708357) has the molecular formula C16H26F2N2O2Si
and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| PubChem CID | 156708357 |
| Molecular Formula | C16H26F2N2O2Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1nc(C2=CCC(F)(F)CC2)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H26F2N2O2Si/c1-21-15-19-14(13-5-7-16(17,18)8-6-13)11-20(15)12-22-9-10-23(2,3)4/h5,11H,6-10,12H2,1-4H3 |
| InChIKey | HGVRVDAKXBKVEN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane?
The IUPAC name of 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane (CID 156708357) is 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane.
What is the SMILES notation for 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane?
The canonical SMILES for 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane is COc1nc(C2=CCC(F)(F)CC2)cn1COCC[Si](C)(C)C.
What is the InChIKey of 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane?
The InChIKey is HGVRVDAKXBKVEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26F2N2O2Si/c1-21-15-19-14(13-5-7-16(17,18)8-6-13)11-20(15)12-22-9-10-23(2,3)4/h5,11H,6-10,12H2,1-4H3.
What are the key properties of 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane?
2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane has a molecular weight of 344.48 g/mol, XLogP of 4.41, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(4,4-difluorocyclohexen-1-yl)-2-methoxyimidazol-1-yl]methoxy]ethyl-trimethylsilane is sourced from PubChem (CID 156708357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).