About 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide
4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide (PubChem CID 156708431) has the molecular formula C9H11BrF3N3O2
and a molecular weight of 330.10 g/mol. Its IUPAC name is 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide |
| PubChem CID | 156708431 |
| Molecular Formula | C9H11BrF3N3O2 |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide |
| SMILES | COc1nc(Br)cn1C(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C9H11BrF3N3O2/c1-18-8-15-6(10)5-16(8)7(17)14-4-2-3-9(11,12)13/h5H,2-4H2,1H3,(H,14,17) |
| InChIKey | XMEZXCXKPHJIDE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide?
The IUPAC name of 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide (CID 156708431) is 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide.
What is the SMILES notation for 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide?
The canonical SMILES for 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide is COc1nc(Br)cn1C(=O)NCCCC(F)(F)F.
What is the InChIKey of 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide?
The InChIKey is XMEZXCXKPHJIDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrF3N3O2/c1-18-8-15-6(10)5-16(8)7(17)14-4-2-3-9(11,12)13/h5H,2-4H2,1H3,(H,14,17).
What are the key properties of 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide?
4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide has a molecular weight of 330.10 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methoxy-N-(4,4,4-trifluorobutyl)imidazole-1-carboxamide is sourced from PubChem (CID 156708431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).