C19H20ClFN8O — CID 156708659
(Z)-3-[1,8a-dihydroimidazo[1,2-a]pyridin-2-ylmethyl(amino)amino]-2-amino-N-[(7-chloro-8-fluoroimidazo[1,5-a]pyridin-1-yl)methyl]prop-2-enamide (PubChem CID 156708659) has the molecular formula C19H20ClFN8O and a molecular weight of 430.88 g/mol. Its IUPAC name is (Z)-3-[1,8a-dihydroimidazo[1,2-a]pyridin-2-ylmethyl(amino)amino]-2-amino-N-[(7-chloro-8-fluoroimidazo[1,5-a]pyridin-1-yl)methyl]prop-2-enamide.
| Compound Name | (Z)-3-[1,8a-dihydroimidazo[1,2-a]pyridin-2-ylmethyl(amino)amino]-2-amino-N-[(7-chloro-8-fluoroimidazo[1,5-a]pyridin-1-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 156708659 |
| Molecular Formula | C19H20ClFN8O |
| Molecular Weight | 430.88 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (Z)-3-[1,8a-dihydroimidazo[1,2-a]pyridin-2-ylmethyl(amino)amino]-2-amino-N-[(7-chloro-8-fluoroimidazo[1,5-a]pyridin-1-yl)methyl]prop-2-enamide |
| SMILES | N/C(=C\N(N)CC1=CN2C=CC=CC2N1)C(=O)NCc1ncn2ccc(Cl)c(F)c12 |
| InChI | InChI=1S/C19H20ClFN8O/c20-13-4-6-28-11-25-15(18(28)17(13)21)7-24-19(30)14(22)10-29(23)9-12-8-27-5-2-1-3-16(27)26-12/h1-6,8,10-11,16,26H,7,9,22-23H2,(H,24,30)/b14-10- |
| InChIKey | FJWONRCMSCCJIV-UVTDQMKNSA-N |
| XLogP | 0.88 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.88 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|