About ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane
ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 156708920) has the molecular formula C11H26N2
and a molecular weight of 186.34 g/mol. Its IUPAC name is ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane |
| PubChem CID | 156708920 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CC.CC.CN1CC2CCC(C1)N2 |
| InChI | InChI=1S/C7H14N2.2C2H6/c1-9-4-6-2-3-7(5-9)8-6;2*1-2/h6-8H,2-5H2,1H3;2*1-2H3 |
| InChIKey | GWAUTWAUACPWQG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane?
The IUPAC name of ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane (CID 156708920) is ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane.
What is the SMILES notation for ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane?
The canonical SMILES for ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane is CC.CC.CN1CC2CCC(C1)N2.
What is the InChIKey of ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane?
The InChIKey is GWAUTWAUACPWQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.2C2H6/c1-9-4-6-2-3-7(5-9)8-6;2*1-2/h6-8H,2-5H2,1H3;2*1-2H3.
What are the key properties of ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane?
ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane has a molecular weight of 186.34 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 156708920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).