C11H26N2 — CID 156708920
ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 156708920) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 156708920 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | ethane;3-methyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CC.CC.CN1CC2CCC(C1)N2 |
| InChI | InChI=1S/C7H14N2.2C2H6/c1-9-4-6-2-3-7(5-9)8-6;2*1-2/h6-8H,2-5H2,1H3;2*1-2H3 |
| InChIKey | GWAUTWAUACPWQG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |