C17H25NO2 — CID 156708984
tert-butyl 4-[(3E)-hexa-1,3,5-trien-3-yl]-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 156708984) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl 4-[(3E)-hexa-1,3,5-trien-3-yl]-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3E)-hexa-1,3,5-trien-3-yl]-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 156708984 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | tert-butyl 4-[(3E)-hexa-1,3,5-trien-3-yl]-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=C/C=C(\C=C)C1=CCN(C(=O)OC(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C17H25NO2/c1-7-9-14(8-2)15-10-11-18(13(3)12-15)16(19)20-17(4,5)6/h7-10,13H,1-2,11-12H2,3-6H3/b14-9+ |
| InChIKey | BHMRBTOPJFLIQO-NTEUORMPSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|