C16H24O — CID 156709204
(E)-4-(2,3-diethylphenyl)but-3-enal;ethane (PubChem CID 156709204) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (E)-4-(2,3-diethylphenyl)but-3-enal;ethane.
| Compound Name | (E)-4-(2,3-diethylphenyl)but-3-enal;ethane |
|---|---|
| PubChem CID | 156709204 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (E)-4-(2,3-diethylphenyl)but-3-enal;ethane |
| SMILES | CC.CCc1cccc(/C=C/CC=O)c1CC |
| InChI | InChI=1S/C14H18O.C2H6/c1-3-12-9-7-10-13(14(12)4-2)8-5-6-11-15;1-2/h5,7-11H,3-4,6H2,1-2H3;1-2H3/b8-5+; |
| InChIKey | TWVRBJQQFOLEJY-HAAWTFQLSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|