About 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen
3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen (PubChem CID 156710072) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen |
| PubChem CID | 156710072 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen |
| SMILES | CC.CCCCNC1=CC(=O)N(C)C1=O.[H][H] |
| InChI | InChI=1S/C9H14N2O2.C2H6.H2/c1-3-4-5-10-7-6-8(12)11(2)9(7)13;1-2;/h6,10H,3-5H2,1-2H3;1-2H3;1H |
| InChIKey | ZYLUJGLAYHRRSJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen?
The IUPAC name of 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen (CID 156710072) is 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen.
What is the SMILES notation for 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen?
The canonical SMILES for 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen is CC.CCCCNC1=CC(=O)N(C)C1=O.[H][H].
What is the InChIKey of 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen?
The InChIKey is ZYLUJGLAYHRRSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2.C2H6.H2/c1-3-4-5-10-7-6-8(12)11(2)9(7)13;1-2;/h6,10H,3-5H2,1-2H3;1-2H3;1H.
What are the key properties of 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen?
3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen has a molecular weight of 214.31 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butylamino)-1-methylpyrrole-2,5-dione;ethane;molecular hydrogen is sourced from PubChem (CID 156710072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).