C10H18LrNO2- — CID 156710230
lawrencium;7-methanidyl-5,5,7-trimethyl-1,4-oxazocan-3-one (PubChem CID 156710230) has the molecular formula C10H18LrNO2- and a molecular weight of 446.26 g/mol. Its IUPAC name is lawrencium;7-methanidyl-5,5,7-trimethyl-1,4-oxazocan-3-one.
| Compound Name | lawrencium;7-methanidyl-5,5,7-trimethyl-1,4-oxazocan-3-one |
|---|---|
| PubChem CID | 156710230 |
| Molecular Formula | C10H18LrNO2- |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | lawrencium;7-methanidyl-5,5,7-trimethyl-1,4-oxazocan-3-one |
| SMILES | [CH2-]C1(C)COCC(=O)NC(C)(C)C1.[Lr] |
| InChI | InChI=1S/C10H18NO2.Lr/c1-9(2)6-10(3,4)11-8(12)5-13-7-9;/h1,5-7H2,2-4H3,(H,11,12);/q-1; |
| InChIKey | JWDFMTOJIRHFKH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|