About CID 156710734
CID 156710734 (PubChem CID 156710734) has the molecular formula C14H10BF3
and a molecular weight of 246.04 g/mol.
Molecular Properties
| Compound Name | CID 156710734 |
| PubChem CID | 156710734 |
| Molecular Formula | C14H10BF3 |
| Molecular Weight | 246.04 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(C(F)(F)F)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H10BF3/c15-9-10-6-7-13(14(16,17)18)12(8-10)11-4-2-1-3-5-11/h1-8H,9H2 |
| InChIKey | BWCYHMVADQPSSI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.04 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156710734 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156710734?
The IUPAC name of CID 156710734 (CID 156710734) is not available.
What is the SMILES notation for CID 156710734?
The canonical SMILES for CID 156710734 is [B]Cc1ccc(C(F)(F)F)c(-c2ccccc2)c1.
What is the InChIKey of CID 156710734?
The InChIKey is BWCYHMVADQPSSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BF3/c15-9-10-6-7-13(14(16,17)18)12(8-10)11-4-2-1-3-5-11/h1-8H,9H2.
What are the key properties of CID 156710734?
CID 156710734 has a molecular weight of 246.04 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156710734 is sourced from PubChem (CID 156710734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).