About N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol
N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol (PubChem CID 156710755) has the molecular formula C16H33NO4
and a molecular weight of 303.44 g/mol. Its IUPAC name is N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol.
Molecular Properties
| Compound Name | N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol |
| PubChem CID | 156710755 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol |
| SMILES | C=CC(=O)NCCC(C)(C)OCCCC.COCCCO |
| InChI | InChI=1S/C12H23NO2.C4H10O2/c1-5-7-10-15-12(3,4)8-9-13-11(14)6-2;1-6-4-2-3-5/h6H,2,5,7-10H2,1,3-4H3,(H,13,14);5H,2-4H2,1H3 |
| InChIKey | LFIRTHFHFIMMHP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol?
The IUPAC name of N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol (CID 156710755) is N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol.
What is the SMILES notation for N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol?
The canonical SMILES for N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol is C=CC(=O)NCCC(C)(C)OCCCC.COCCCO.
What is the InChIKey of N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol?
The InChIKey is LFIRTHFHFIMMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2.C4H10O2/c1-5-7-10-15-12(3,4)8-9-13-11(14)6-2;1-6-4-2-3-5/h6H,2,5,7-10H2,1,3-4H3,(H,13,14);5H,2-4H2,1H3.
What are the key properties of N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol?
N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol has a molecular weight of 303.44 g/mol, XLogP of 2.29, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-butoxy-3-methylbutyl)prop-2-enamide;3-methoxypropan-1-ol is sourced from PubChem (CID 156710755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).